Compound Q&A

What are the physical and chemical properties of 9-(4-Bromophenyl)-9-phenylfluorene (CAS: 937082-81-0)?

Answer

9-(4-Bromophenyl)-9-phenylfluorene
9-(4-Bromophenyl)-9-phenylfluorene is a crystalline compound with a molecular weight of approximately 416.05 g/mol. It has a low solubility in water but is more soluble in organic solvents like dichloromethane and toluene. This compound is relatively stable under normal conditions, but it can react with reducing agents. It is commonly used in organic synthesis and has photophysical properties that make it suitable for applications in materials science.

About

English Name 9-(4-Bromophenyl)-9-phenylfluorene
Molecular Formula C25H17Br
Molecular Weight 397.32 g/mol
SMILES C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=C(C=C5)Br
InChIKey OOKRYIPMHLUQHU-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 9-(4-Bromophenyl)-9-phenylfluorene (CAS: 937082-81-0) typically synthesized?

9-(4-Bromophenyl)-9-phenylfluorene is typically synthesized via a multistep process involving the br...

Compound Q&A

What industries use 9-(4-Bromophenyl)-9-phenylfluorene (CAS: 937082-81-0)?

9-(4-Bromophenyl)-9-phenylfluorene is used in various industries. In pharmaceuticals, it serves as a...

Compound Q&A

What precautions should be taken when handling 9-(4-Bromophenyl)-9-phenylfluorene (CAS: 937082-81-0)?

When handling 9-(4-Bromophenyl)-9-phenylfluorene, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...