Compound Q&A

What are the physical and chemical properties of Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 39945-51-2)?

Answer

Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate
Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 39945-51-2) is a colorless to light yellow crystalline solid. Its molecular weight is approximately 242.3 g/mol. It is slightly soluble in water but soluble in organic solvents such as ethanol and acetone. It is reactive towards nucleophiles and can undergo ester hydrolysis under basic conditions.

About

CAS No 39945-51-2
English Name Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate
Molecular Formula C14H19NO3
Molecular Weight 249.31 g/mol
SMILES C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)CO
InChIKey XLWOOUZKMJBINO-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 39945-51-2) typically synthesized?

Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate is typically synthesized via a condensation reactio...

Compound Q&A

What industries use Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 39945-51-2)?

Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 39945-51-2) is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 39945-51-2)?

When handling Benzyl 3-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 39945-51-2), it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...