Compound Q&A

How is 3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid (CAS: 129768-28-1) typically synthesized?

Answer

3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid
3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid can be synthesized via the condensation of trifluoromethylated pyrazoles with carboxylic acids. Common methods involve using acyl chlorides or acid anhydrides as precursors. The reaction often requires a Lewis acid catalyst and is conducted in anhydrous conditions to improve yield and selectivity.

About

English Name 3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid
Molecular Formula C5H3F3N2O2
Molecular Weight 180.08 g/mol
SMILES C1=C(NN=C1C(=O)O)C(F)(F)F
InChIKey CIVNBJPTGRMGRS-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid (CAS: 129768-28-1)?

3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid is a crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid (CAS: 129768-28-1)?

3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid is utilized in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid (CAS: 129768-28-1)?

When handling 3-(Trifluoromethyl)-1H-pyrazole-5-carboxylic acid, it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...