Compound Q&A

What industries use 2-Propenoic acid, 3-(nitrophenyl) (CAS: 612-41-9)?

Answer

2-Propenoic acid, 3-(nitrophenyl)-
2-Propenoic acid, 3-(nitrophenyl) is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for the development of advanced materials, and in the chemical industry for the production of sensors and semiconductors.

About

CAS No 612-41-9
English Name 2-Propenoic acid, 3-(nitrophenyl)-
Molecular Formula C9H7NO4
Molecular Weight 193.16 g/mol
SMILES C1=CC=C(C(=C1)C=CC(=O)O)[N+](=O)[O-]
InChIKey BBQDLDVSEDAYAA-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Propenoic acid, 3-(nitrophenyl) (CAS: 612-41-9)?

2-Propenoic acid, 3-(nitrophenyl) is a crystalline solid with a molecular weight of approximately 18...

Compound Q&A

How is 2-Propenoic acid, 3-(nitrophenyl) (CAS: 612-41-9) typically synthesized?

2-Propenoic acid, 3-(nitrophenyl) is typically synthesized via nitration of 2-propenoic acid followe...

Compound Q&A

What precautions should be taken when handling 2-Propenoic acid, 3-(nitrophenyl) (CAS: 612-41-9)?

When handling 2-Propenoic acid, 3-(nitrophenyl), ensure proper personal protective equipment (PPE) i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...