Compound Q&A

How is (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - dicyclohexyl(2',4',6'-triisopropyl-3,6-dimethoxy-2-biphenylyl)phosphine (CAS: 1470372-59-8) typically synthesized?

Answer

(2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - dicyclohexyl(2',4',6'-triisopropyl-3,6-dimethoxy-2-biphenylyl)phosphine (1:1)
This compound is synthesized via a multi-step process involving the coupling of a palladium complex with a phosphine ligand. Commonly, the synthesis involves the use of palladium(II) acetate and a phosphine ligand under controlled conditions. The reaction is typically carried out in the presence of a base and a suitable solvent to achieve high selectivity and yield.

About

English Name (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - dicyclohexyl(2',4',6'-triisopropyl-3,6-dimethoxy-2-biphenylyl)phosphine (1:1)
Molecular Formula C48H66NO5PPdS
Molecular Weight 906.52 g/mol
SMILES COc1ccc(OC)c(c1P(C2CCCCC2)C3CCCCC3)c4c(cc(cc4C(C)C)C(C)C)C(C)C.CS(=O)(=O)O[Pd]c1ccccc1c2ccccc2N
InChIKey PQYBJDCHLVJYSD-UHFFFAOYSA-M
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What industries use (2'-Amino-2-biphenylyl)(methanesulfonato-kappaO)palladium - dicyclohexyl(2',4',6'-triisopropyl-3,6-dimethoxy-2-biphenylyl)phosphine (CAS: 1470372-59-8)?

This compound is primarily used in the pharmaceutical and chemical industries for its role as a liga...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...