Compound Q&A

What industries use 2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate (CAS: 58086-67-2)?

Answer

2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate
2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate (CAS: 58086-67-2) is primarily used in the pharmaceutical industry for the synthesis of various compounds. It is also utilized in the polymer industry for the functionalization of polymer chains. Additionally, it plays a role in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 58086-67-2
English Name 2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate
Molecular Formula C13H14FNO3S
Molecular Weight 283.32 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+]1=CC=CC=C1F
InChIKey HQWDKLAIDBOLFE-UHFFFAOYSA-M
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate (CAS: 58086-67-2)?

2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate (CAS: 58086-67-2) is a crystalline compound wit...

Compound Q&A

How is 2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate (CAS: 58086-67-2) typically synthesized?

2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate is typically synthesized through the sulfonatio...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate (CAS: 58086-67-2)?

When handling 2-Fluoro-1-methylpyridinium 4-methylbenzenesulfonate (CAS: 58086-67-2), it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...