Compound Q&A

What industries use 2,4-Diaminophenol sulfate (1:1) (CAS: 74283-34-4)?

Answer

2,4-Diaminophenol sulfate (1:1)
2,4-Diaminophenol sulfate (1:1) (CAS: 74283-34-4) is used in various industries, including pharmaceuticals for the production of certain medications, polymers for the synthesis of advanced materials, and sensors for the detection of chemical compounds. It is also employed in the semiconductor industry for specific applications where its basic properties are advantageous.

About

CAS No 74283-34-4
English Name 2,4-Diaminophenol sulfate (1:1)
Molecular Formula C6H10N2O5S
Molecular Weight 222.22 g/mol
SMILES C1=CC(=C(C=C1N)N)O.OS(=O)(=O)O
InChIKey JKMWKYDJCPSJSI-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Diaminophenol sulfate (1:1) (CAS: 74283-34-4)?

2,4-Diaminophenol sulfate (1:1) (CAS: 74283-34-4) is a crystalline solid with a molecular weight of ...

Compound Q&A

How is 2,4-Diaminophenol sulfate (1:1) (CAS: 74283-34-4) typically synthesized?

2,4-Diaminophenol sulfate (1:1) (CAS: 74283-34-4) is typically synthesized by the sulfation of 2,4-d...

Compound Q&A

What precautions should be taken when handling 2,4-Diaminophenol sulfate (1:1) (CAS: 74283-34-4)?

When handling 2,4-Diaminophenol sulfate (1:1) (CAS: 74283-34-4), it is important to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...