Compound Q&A

What industries use 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid (CAS: 7303-50-6)?

Answer

2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid
2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid finds applications in the pharmaceutical industry, where it is used as an intermediate in the synthesis of anti-inflammatory and antiviral drugs. It is also utilized in the polymer industry as a monomer for the production of advanced materials. Additionally, it has potential uses in sensor technology and semiconductor processing due to its unique chemical properties.

About

CAS No 7303-50-6
English Name 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid
Molecular Formula C10H11N3O2
Molecular Weight 205.22 g/mol
SMILES C1=CC2=C(NC=C2CC(C(=O)O)N)N=C1
InChIKey SNLOIIPRZGMRAB-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid (CAS: 7303-50-6)?

2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid is a white crystalline solid with a molecula...

Compound Q&A

How is 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid (CAS: 7303-50-6) typically synthesized?

2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid can be synthesized using a multi-step proces...

Compound Q&A

What precautions should be taken when handling 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid (CAS: 7303-50-6)?

When handling 2-amino-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...