Compound Q&A

What are the physical and chemical properties of N-(4-Bromophenyl)-2,6-dihydroxybenzamide (CAS: 20788-07-2)?

Answer

N-(4-Bromophenyl)-2,6-dihydroxybenzamide
N-(4-Bromophenyl)-2,6-dihydroxybenzamide (CAS: 20788-07-2) is a crystalline solid with a molecular weight of approximately 327.03 g/mol. It has a high solubility in polar solvents such as dimethyl sulfoxide (DMSO) and methanol, but is poorly soluble in water. This compound is relatively stable under normal conditions but can undergo hydrolysis in the presence of acid or base. It is not reactive towards common organic reagents but can undergo electrophilic aromatic substitution reactions.

About

CAS No 20788-07-2
English Name N-(4-Bromophenyl)-2,6-dihydroxybenzamide
Molecular Formula C13H10BrNO3
Molecular Weight 308.13 g/mol
SMILES C1=CC(=C(C(=C1)O)C(=O)NC2=CC=C(C=C2)Br)O
InChIKey IHYNKGRWCDKNEG-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is N-(4-Bromophenyl)-2,6-dihydroxybenzamide (CAS: 20788-07-2) typically synthesized?

N-(4-Bromophenyl)-2,6-dihydroxybenzamide is typically synthesized via the coupling of 4-bromobenzoic...

Compound Q&A

What industries use N-(4-Bromophenyl)-2,6-dihydroxybenzamide (CAS: 20788-07-2)?

N-(4-Bromophenyl)-2,6-dihydroxybenzamide (CAS: 20788-07-2) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling N-(4-Bromophenyl)-2,6-dihydroxybenzamide (CAS: 20788-07-2)?

When handling N-(4-Bromophenyl)-2,6-dihydroxybenzamide (CAS: 20788-07-2), ensure the use of appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...