Compound Q&A

What industries use 2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (CAS: 57260-72-7)?

Answer

2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (1:1)
2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (CAS: 57260-72-7) is primarily used in the pharmaceutical and polymer industries. It acts as a key intermediate in the synthesis of various drugs and is also utilized in the production of functional polymers. Additionally, it finds applications in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 57260-72-7
English Name 2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (1:1)
Molecular Formula C11H20N2O6
Molecular Weight 276.29 g/mol
SMILES CC(C)(C)OC(=O)N1CCNCC1.C(=O)(C(=O)O)O
InChIKey RJWRZAGRJJOLJX-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (CAS: 57260-72-7)?

2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (CAS: 57260-72-7) is a crystalline solid wi...

Compound Q&A

How is 2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (CAS: 57260-72-7) typically synthesized?

2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (CAS: 57260-72-7) is synthesized through a ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (CAS: 57260-72-7)?

When handling 2-Methyl-2-propanyl 1-piperazinecarboxylate ethanedioate (CAS: 57260-72-7), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...