Compound Q&A

What are the physical and chemical properties of Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite (CAS: 575-75-7)?

Answer

Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite
Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite (CAS: 575-75-7) is a crystalline solid with a molecular weight of approximately 311.37 g/mol. It is slightly soluble in water and has good solubility in organic solvents. The compound is relatively stable under normal conditions but can react with strong acids to release phosphine. It is a valuable reagent in organic synthesis and polymer chemistry.

About

CAS No 575-75-7
English Name Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite
Molecular Formula C9H13NNaO2P
Molecular Weight 220.16 g/mol
SMILES CC1=C(C=CC(=C1)N(C)C)[P+](=O)[O-].[Na+]
InChIKey ZOJLSTZZHUYVPY-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite (CAS: 575-75-7) typically synthesized?

Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite (CAS: 575-75-7) is typically synthesiz...

Compound Q&A

What industries use Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite (CAS: 575-75-7)?

Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite (CAS: 575-75-7) is used in the pharmac...

Compound Q&A

What precautions should be taken when handling Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite (CAS: 575-75-7)?

When handling Sodium hydrogen [4-(dimethylamino)-2-methylphenyl]phosphonite (CAS: 575-75-7), it is i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...