Compound Q&A

What precautions should be taken when handling 4-(3,5,7-Trimethylnonyl)phenol (CAS: 210555-94-5)?

Answer

4-(3,5,7-Trimethylnonyl)phenol
When handling 4-(3,5,7-Trimethylnonyl)phenol, it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up immediately with appropriate absorbents, and the area should be thoroughly washed. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 4-(3,5,7-Trimethylnonyl)phenol
Molecular Formula C18H30O
Molecular Weight 262.44 g/mol
SMILES CCC(C)CC(C)CC(C)CCC1=CC=C(C=C1)O
InChIKey ZLIZUPQZVMVLPA-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3,5,7-Trimethylnonyl)phenol (CAS: 210555-94-5)?

4-(3,5,7-Trimethylnonyl)phenol has a crystalline form with a molecular weight of approximately 264.4...

Compound Q&A

How is 4-(3,5,7-Trimethylnonyl)phenol (CAS: 210555-94-5) typically synthesized?

4-(3,5,7-Trimethylnonyl)phenol is typically synthesized by the reduction of 4-(3,5,7-Trimethylheptyl...

Compound Q&A

What industries use 4-(3,5,7-Trimethylnonyl)phenol (CAS: 210555-94-5)?

4-(3,5,7-Trimethylnonyl)phenol is used in various industries. It is a key component in the productio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...