Compound Q&A

What are the physical and chemical properties of Vicenin 3 (CAS: 59914-91-9)?

Answer

Vicenin 3
Vicenin 3 (CAS: 59914-91-9) is a crystalline compound with a molecular weight of approximately 714.24 g/mol. It has a melting point of 230-235°C and is poorly soluble in water but soluble in ethanol and methanol. Vicenin 3 is relatively stable under normal conditions but can be sensitive to light and air oxidation.

About

CAS No 59914-91-9
English Name Vicenin 3
Molecular Formula C26H28O14
Molecular Weight 564.5 g/mol
SMILES C1C(C(C(C(O1)C2=C3C(=C(C(=C2O)C4C(C(C(C(O4)CO)O)O)O)O)C(=O)C=C(O3)C5=CC=C(C=C5)O)O)O)O
InChIKey MMDUKUSNQNWVET-MCIQUCDDSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Vicenin 3 (CAS: 59914-91-9) typically synthesized?

Vicenin 3 can be synthesized through a multistep process involving the condensation of 3,5-dihydroxy...

Compound Q&A

What industries use Vicenin 3 (CAS: 59914-91-9)?

Vicenin 3 (CAS: 59914-91-9) is primarily used in the pharmaceutical industry for its antioxidant and...

Compound Q&A

What precautions should be taken when handling Vicenin 3 (CAS: 59914-91-9)?

When handling Vicenin 3 (CAS: 59914-91-9), it is essential to use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...