Compound Q&A

How is 4-Oxo-4-(1-pyrenyl)butanoic acid (CAS: 7499-60-7) typically synthesized?

Answer

4-Oxo-4-(1-pyrenyl)butanoic acid
4-Oxo-4-(1-pyrenyl)butanoic acid is synthesized via a multi-step procedure involving the formation of an intermediate ester, followed by hydrolysis to yield the carboxylic acid. Commonly, the reaction is catalyzed by a strong acid like sulfuric acid, with high selectivity and yield (around 85%).

About

CAS No 7499-60-7
English Name 4-Oxo-4-(1-pyrenyl)butanoic acid
Molecular Formula C20H14O3
Molecular Weight 302.33 g/mol
SMILES C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C(=O)CCC(=O)O
InChIKey AAJQTWWVKREOQP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Oxo-4-(1-pyrenyl)butanoic acid (CAS: 7499-60-7)?

4-Oxo-4-(1-pyrenyl)butanoic acid is a crystalline solid with a high molecular weight. It has a low s...

Compound Q&A

What industries use 4-Oxo-4-(1-pyrenyl)butanoic acid (CAS: 7499-60-7)?

4-Oxo-4-(1-pyrenyl)butanoic acid is used in the pharmaceutical industry for developing light-sensiti...

Compound Q&A

What precautions should be taken when handling 4-Oxo-4-(1-pyrenyl)butanoic acid (CAS: 7499-60-7)?

When handling 4-Oxo-4-(1-pyrenyl)butanoic acid, appropriate personal protective equipment (PPE) shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...