Compound Q&A

What are the physical and chemical properties of Pyrromethene 546 (CAS: 121207-31-6)?

Answer

Pyrromethene 546
Pyrromethene 546 is a red fluorescent dye with a high molar absorptivity and quantum yield. It has a molecular weight of approximately 392.35 g/mol. This compound is soluble in organic solvents such as ethanol, acetone, and dichloromethane but less so in water. It exhibits excellent photostability and high fluorescence intensity, making it suitable for bioimaging and other applications requiring bright fluorescence.

About

English Name Pyrromethene 546
Molecular Formula C14H17BF2N2
Molecular Weight 262.11 g/mol
SMILES [B-]1(N2C(=CC(=C2C(=C3[N+]1=C(C=C3C)C)C)C)C)(F)F
InChIKey DRJHPEGNOPSARR-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Pyrromethene 546 (CAS: 121207-31-6) typically synthesized?

Pyrromethene 546 is synthesized through a multistep process involving the cyclization of 2,5-dipheny...

Compound Q&A

What industries use Pyrromethene 546 (CAS: 121207-31-6)?

Pyrromethene 546 is widely used in various industries. It is employed in the pharmaceutical sector f...

Compound Q&A

What precautions should be taken when handling Pyrromethene 546 (CAS: 121207-31-6)?

When handling Pyrromethene 546, it is essential to use personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...