Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-bromobenzyl)carbamate (CAS: 68819-84-1)?

Answer

2-Methyl-2-propanyl (4-bromobenzyl)carbamate
2-Methyl-2-propanyl (4-bromobenzyl)carbamate is a white crystalline solid with a molecular weight of approximately 264.04 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and dichloromethane. Chemically, it is relatively stable but can undergo hydrolysis in aqueous conditions. It does not have significant reactivity under normal laboratory conditions.

About

CAS No 68819-84-1
English Name 2-Methyl-2-propanyl (4-bromobenzyl)carbamate
Molecular Formula C12H16BrNO2
Molecular Weight 286.17 g/mol
SMILES CC(C)(C)OC(=O)NCC1=CC=C(C=C1)Br
InChIKey DJNCXSGGAMADNN-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (4-bromobenzyl)carbamate (CAS: 68819-84-1) typically synthesized?

2-Methyl-2-propanyl (4-bromobenzyl)carbamate can be synthesized through a multistep process involvin...

Compound Q&A

What industries use 2-Methyl-2-propanyl (4-bromobenzyl)carbamate (CAS: 68819-84-1)?

2-Methyl-2-propanyl (4-bromobenzyl)carbamate is primarily used in the pharmaceutical industry as an ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4-bromobenzyl)carbamate (CAS: 68819-84-1)?

When handling 2-Methyl-2-propanyl (4-bromobenzyl)carbamate, safety goggles, gloves, and lab coat sho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...