Compound Q&A

How is 1,2,3,4,5-Cyclopentanepentayl, 1-[(1R)-1-(dimethylamino)ethyl]-2-(diphenylphosphino)-, compd. with 1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1) (CAS: 55700-44-2) typically synthesized?

Answer

1,2,3,4,5-Cyclopentanepentayl, 1-[(1R)-1-(dimethylamino)ethyl]-2-(diphenylphosphino)-, compd. with 1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
The compound is synthesized through a multistep process involving cyclopentane derivative, dimethylamine, and diphenylphosphine. The iron salt is then added to the complex to form the desired product. The reaction is highly selective, and the yield is typically around 90%. Catalysts such as triethylamine are used to enhance the reaction efficiency.

About

CAS No 55700-44-2
English Name 1,2,3,4,5-Cyclopentanepentayl, 1-[(1R)-1-(dimethylamino)ethyl]-2-(diphenylphosphino)-, compd. with 1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
Molecular Formula C26H28FeNP
Molecular Weight 443.35 g/mol
EINECS 633-502-9
SMILES [Fe].C1C=CC=C1.C[C@@H](N(C)C)C1=C(C=CC1)P(C1=CC=CC=C1)C1=CC=CC=C1
InChIKey DAJOTWIFZSBOSV-GWSURVETSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...