Compound Q&A

What industries use 1-Naphthylhydrazine hydrochloride (CAS: 2243-56-3)?

Answer

1-Naphthylhydrazine hydrochloride (1:1)
1-Naphthylhydrazine hydrochloride (CAS: 2243-56-3) is used in various industries, including pharmaceuticals for the synthesis of certain drugs, and in the production of dyes and pigments. It is also utilized in the development of sensors and as an intermediate in the synthesis of organic compounds. Additionally, it finds applications in the polymer industry for the modification of polymers.

About

CAS No 2243-56-3
English Name 1-Naphthylhydrazine hydrochloride (1:1)
Molecular Formula C10H11ClN2
Molecular Weight 194.66 g/mol
SMILES C1=CC=C2C(=C1)C=CC=C2NN.Cl
InChIKey FYSSYOCJFZSKNW-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Naphthylhydrazine hydrochloride (CAS: 2243-56-3)?

1-Naphthylhydrazine hydrochloride (CAS: 2243-56-3) is a white crystalline solid with a molecular wei...

Compound Q&A

How is 1-Naphthylhydrazine hydrochloride (CAS: 2243-56-3) typically synthesized?

1-Naphthylhydrazine hydrochloride is typically synthesized by the reaction of 1-naphthylhydrazine wi...

Compound Q&A

What precautions should be taken when handling 1-Naphthylhydrazine hydrochloride (CAS: 2243-56-3)?

When handling 1-Naphthylhydrazine hydrochloride (CAS: 2243-56-3), it is important to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...