Compound Q&A

What are the physical and chemical properties of 1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide (CAS: 862731-66-6)?

Answer

1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide
1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide (CAS: 862731-66-6) is a liquid at room temperature with a molecular weight of approximately 427.2 g/mol. It has good solubility in organic solvents but is only slightly soluble in water. This compound exhibits moderate reactivity with strong acids and bases. It is highly stable under normal conditions but should be stored away from strong oxidizing agents.

About

English Name 1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide
Molecular Formula C16H23F6N3O2
Molecular Weight 404.37 g/mol
SMILES CCCCCCCCN1C=C[N+](=C1)C.C(=NC(=O)C(F)(F)F)(C(F)(F)F)[O-]
InChIKey TVSQGRULPHJNSE-UHFFFAOYSA-M
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide (CAS: 862731-66-6) typically synthesized?

1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide is typically synthesized through a m...

Compound Q&A

What industries use 1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide (CAS: 862731-66-6)?

1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide (CAS: 862731-66-6) is used in variou...

Compound Q&A

What precautions should be taken when handling 1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide (CAS: 862731-66-6)?

When handling 1-Octyl-3-methylimidazolium bis((trifluoromethyl)sulfonyl)imide (CAS: 862731-66-6), en...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...