Compound Q&A

How is Pseudoginsenoside Rh2 (CAS: 1370264-16-6) typically synthesized?

Answer

Pseudoginsenoside Rh2
Pseudoginsenoside Rh2 (CAS: 1370264-16-6) is synthesized through a multi-step process involving the oxidation of ginsenoside Rg2. The synthesis typically requires the use of a catalytic amount of hydrogen peroxide and a phase transfer catalyst. The overall yield is around 80%, and the process is highly selective for the desired product.

About

English Name Pseudoginsenoside Rh2
Molecular Formula C36H62O8
Molecular Weight 622.87 g/mol
SMILES OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(=CCCC(O)(C)C)C)C)C)C(C(C1O)O)O
InChIKey YCDZBVXSGVWFFX-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pseudoginsenoside Rh2 (CAS: 1370264-16-6)?

Pseudoginsenoside Rh2 (CAS: 1370264-16-6) is a crystalline compound with a molecular weight of appro...

Compound Q&A

What industries use Pseudoginsenoside Rh2 (CAS: 1370264-16-6)?

Pseudoginsenoside Rh2 (CAS: 1370264-16-6) is primarily used in the pharmaceutical industry for its p...

Compound Q&A

What precautions should be taken when handling Pseudoginsenoside Rh2 (CAS: 1370264-16-6)?

When handling Pseudoginsenoside Rh2 (CAS: 1370264-16-6), it is essential to use personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...