Compound Q&A

How is 2-(2,4-Dinitrophenyl)ethanol (CAS: 4836-69-5) typically synthesized?

Answer

2-(2,4-Dinitrophenyl)ethanol
2-(2,4-Dinitrophenyl)ethanol is typically synthesized by the nitration of 2-ethoxyphenol followed by hydrolysis. Commonly, this involves the use of a nitration mixture of concentrated nitric acid and concentrated sulfuric acid as the nitration reagent. The reaction yields the target compound in good to excellent purity, with careful control of reaction conditions ensuring high selectivity and yield.

About

CAS No 4836-69-5
English Name 2-(2,4-Dinitrophenyl)ethanol
Molecular Formula C8H8N2O5
Molecular Weight 212.16 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CCO
InChIKey AONMTYOVKUOHQP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,4-Dinitrophenyl)ethanol (CAS: 4836-69-5)?

2-(2,4-Dinitrophenyl)ethanol is a crystalline compound with a molecular weight of approximately 286....

Compound Q&A

What industries use 2-(2,4-Dinitrophenyl)ethanol (CAS: 4836-69-5)?

2-(2,4-Dinitrophenyl)ethanol is used in the pharmaceutical industry for the synthesis of intermediat...

Compound Q&A

What precautions should be taken when handling 2-(2,4-Dinitrophenyl)ethanol (CAS: 4836-69-5)?

When handling 2-(2,4-Dinitrophenyl)ethanol, it is crucial to use personal protective equipment such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...