Compound Q&A

What are the physical and chemical properties of Methyl 4-chloro-3-methylbenzoate (CAS: 91367-05-4)?

Answer

Methyl 4-chloro-3-methylbenzoate
Methyl 4-chloro-3-methylbenzoate (CAS: 91367-05-4) is a white or off-white crystalline solid with a molecular weight of approximately 219.64 g/mol. It has a melting point of 55-57°C and is slightly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is relatively stable under normal conditions but may react with strong bases. It is used in various applications due to its chemical reactivity and stability.

About

CAS No 91367-05-4
English Name Methyl 4-chloro-3-methylbenzoate
Molecular Formula C9H9ClO2
Molecular Weight 184.62 g/mol
SMILES CC1=C(C=CC(=C1)C(=O)OC)Cl
InChIKey QOTGNXMPQNGYDM-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Methyl 4-chloro-3-methylbenzoate (CAS: 91367-05-4) typically synthesized?

Methyl 4-chloro-3-methylbenzoate (CAS: 91367-05-4) is typically synthesized via the reaction of 4-ch...

Compound Q&A

What industries use Methyl 4-chloro-3-methylbenzoate (CAS: 91367-05-4)?

Methyl 4-chloro-3-methylbenzoate (CAS: 91367-05-4) is used in the pharmaceutical, polymer, and chemi...

Compound Q&A

What precautions should be taken when handling Methyl 4-chloro-3-methylbenzoate (CAS: 91367-05-4)?

When handling Methyl 4-chloro-3-methylbenzoate (CAS: 91367-05-4), appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...