Compound Q&A

What industries use 5-Fluoro-2-nitrobenzaldehyde (CAS: 395-81-3)?

Answer

5-Fluoro-2-nitrobenzaldehyde
5-Fluoro-2-nitrobenzaldehyde (CAS: 395-81-3) is used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry for the production of special plastics and in the sensor industry for developing chemical sensors.

About

CAS No 395-81-3
English Name 5-Fluoro-2-nitrobenzaldehyde
Molecular Formula C7H4FNO3
Molecular Weight 169.11 g/mol
SMILES C1=CC(=C(C=C1F)C=O)[N+](=O)[O-]
InChIKey KKAFVHUJZPVWND-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Fluoro-2-nitrobenzaldehyde (CAS: 395-81-3)?

5-Fluoro-2-nitrobenzaldehyde (CAS: 395-81-3) is a crystalline compound with a molecular weight of ap...

Compound Q&A

How is 5-Fluoro-2-nitrobenzaldehyde (CAS: 395-81-3) typically synthesized?

5-Fluoro-2-nitrobenzaldehyde (CAS: 395-81-3) is typically synthesized by nitration of 5-fluorobenzen...

Compound Q&A

What precautions should be taken when handling 5-Fluoro-2-nitrobenzaldehyde (CAS: 395-81-3)?

When handling 5-Fluoro-2-nitrobenzaldehyde (CAS: 395-81-3), ensure use of appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...