Compound Q&A

What are the physical and chemical properties of Disodium 1,3-dihydroxy-2-propanyl phosphate (CAS: 819-83-0)?

Answer

Disodium 1,3-dihydroxy-2-propanyl phosphate
Disodium 1,3-dihydroxy-2-propanyl phosphate (CAS: 819-83-0) is a white crystalline solid with a molecular weight of approximately 298.14 g/mol. It is moderately soluble in water and exhibits reactive phosphate ester chemistry. The compound is known for its ability to form stable aqueous solutions and its use in various applications due to its chemical stability and reactivity.

About

CAS No 819-83-0
English Name Disodium 1,3-dihydroxy-2-propanyl phosphate
Molecular Formula C3H7Na2O6P
Molecular Weight 216.04 g/mol
SMILES C(C(CO)OP(=O)([O-])[O-])O.[Na+].[Na+]
InChIKey AVPCPPOOQICIRJ-UHFFFAOYSA-L
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Disodium 1,3-dihydroxy-2-propanyl phosphate (CAS: 819-83-0) typically synthesized?

Disodium 1,3-dihydroxy-2-propanyl phosphate (CAS: 819-83-0) is synthesized via the esterification of...

Compound Q&A

What industries use Disodium 1,3-dihydroxy-2-propanyl phosphate (CAS: 819-83-0)?

Disodium 1,3-dihydroxy-2-propanyl phosphate (CAS: 819-83-0) finds use in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Disodium 1,3-dihydroxy-2-propanyl phosphate (CAS: 819-83-0)?

When handling Disodium 1,3-dihydroxy-2-propanyl phosphate (CAS: 819-83-0), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...