Compound Q&A

How should 4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine) (CAS: 81892-72-0) be stored?

Answer

4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine)
4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine) should be stored in a cool, dry, and well-ventilated area, preferably in a sealed container to prevent moisture absorption. It should be kept away from direct sunlight and heat sources to prevent degradation. The container should be tightly sealed to maintain its integrity and prevent contamination.

About

CAS No 81892-72-0
English Name 4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine)
Molecular Formula C15H20N4O2
Molecular Weight 288.35 g/mol
SMILES c1cc(c(cc1N)N)OCCCOc2ccc(cc2N)N
InChIKey MWKPYVXITDAZLL-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What is 4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine) (CAS: 81892-72-0)?

4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine), also known as Tetramethylenebis(1,3-benzenedia...

Compound Q&A

What are the main uses of 4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine) (CAS: 81892-72-0)?

4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine) is primarily used in the synthesis of dyes, pol...

Compound Q&A

Is 4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine) (CAS: 81892-72-0) safe?

4,4'-[1,3-Propanediylbis(oxy)]di(1,3-benzenediamine) is generally considered safe when handled prope...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...