Compound Q&A

What are the main uses of 5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine (CAS: 85583-54-6)?

Answer

5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine
5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine (CAS: 85583-54-6) is primarily used in the pharmaceutical industry for the development of certain chemical intermediates and as a research compound. It may also have applications in analytical chemistry and other research fields.

About

CAS No 85583-54-6
English Name 5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine
Molecular Formula C15H16N2O3
Molecular Weight 272.3 g/mol
SMILES CCc1ccc(nc1)CCOc1ccc(cc1)[N+](=O)[O-]
InChIKey KGCCHRPMSPXKJE-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What is 5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine (CAS: 85583-54-6)?

5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine (CAS: 85583-54-6) is a complex organic compound. It feat...

Compound Q&A

Is 5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine (CAS: 85583-54-6) safe?

5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine (CAS: 85583-54-6) is generally safe when handled under p...

Compound Q&A

How should 5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine (CAS: 85583-54-6) be stored?

5-Ethyl-2-[2-(4-nitrophenoxy)ethyl]pyridine (CAS: 85583-54-6) should be stored in a cool, dry place,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...