Compound Q&A

What are the main uses of 5-Hydroxy-2-nitrobenzoic acid (CAS: 610-37-7)?

Answer

5-Hydroxy-2-nitrobenzoic acid
5-Hydroxy-2-nitrobenzoic acid (CAS: 610-37-7) is primarily used as an intermediate in the synthesis of other compounds, particularly in the pharmaceutical industry. It is also utilized in research and development for its unique chemical properties and in analytical chemistry as a reagent.

About

CAS No 610-37-7
English Name 5-Hydroxy-2-nitrobenzoic acid
Molecular Formula C7H5NO5
Molecular Weight 183.12 g/mol
SMILES C1=CC(=C(C=C1O)C(=O)O)[N+](=O)[O-]
InChIKey BUHKQTKKZAXSMH-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What is 5-Hydroxy-2-nitrobenzoic acid (CAS: 610-37-7)?

5-Hydroxy-2-nitrobenzoic acid (CAS: 610-37-7) is an organic compound with the molecular formula C7H5...

Compound Q&A

Is 5-Hydroxy-2-nitrobenzoic acid (CAS: 610-37-7) safe?

5-Hydroxy-2-nitrobenzoic acid (CAS: 610-37-7) is generally safe when handled with proper precautions...

Compound Q&A

How should 5-Hydroxy-2-nitrobenzoic acid (CAS: 610-37-7) be stored?

5-Hydroxy-2-nitrobenzoic acid (CAS: 610-37-7) should be stored in a tightly sealed container in a co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...