Compound Q&A

What is 4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid (CAS: 130-23-4)?

Answer

4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid
4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid is a polyfunctional organic compound with the CAS number 130-23-4. It features a naphthalene ring with two sulfonic acid groups, an amino group, and a hydroxyl group. This compound is used in various applications including dyes, pH indicators, and analytical reagents.

About

CAS No 130-23-4
English Name 4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid
Molecular Formula C10H9NO7S2
Molecular Weight 319.32 g/mol
SMILES C1=CC(=C2C=C(C=C(C2=C1N)O)S(=O)(=O)O)S(=O)(=O)O
InChIKey ZUQOBHTUMCEQBG-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the main uses of 4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid (CAS: 130-23-4)?

4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid is primarily used as a pH indicator, dye precursor,...

Compound Q&A

Is 4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid (CAS: 130-23-4) safe?

4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid is generally considered safe for laboratory use whe...

Compound Q&A

How should 4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid (CAS: 130-23-4) be stored?

4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid should be stored in a cool, dry place away from dir...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...