Compound Q&A

What is Di(dipivaloylmethanato)copper (CAS: 14040-05-2)?

Answer

Di(dipivaloylmethanato)copper
Di(dipivaloylmethanato)copper is a copper complex with the chemical formula [Cu(C5H7OO)2]. It is a coordination compound with dipivaloylmethanato ligands. This compound is stable and can be used in various applications due to its unique chemical properties.

About

CAS No 14040-05-2
English Name Di(dipivaloylmethanato)copper
Molecular Formula C22H38CuO4
Molecular Weight 430.1 g/mol
SMILES CC(C)(C)C(=CC(=O)C(C)(C)C)[O-].CC(C)(C)C(=CC(=O)C(C)(C)C)[O-].[Cu+2]
InChIKey VCIKJQZFNVXWPF-ATMONBRVSA-L
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the main uses of Di(dipivaloylmethanato)copper (CAS: 14040-05-2)?

Di(dipivaloylmethanato)copper is primarily used in catalysis, particularly in organic synthesis, and...

Compound Q&A

Is Di(dipivaloylmethanato)copper (CAS: 14040-05-2) safe?

Di(dipivaloylmethanato)copper is generally considered safe for laboratory use when handled with prop...

Compound Q&A

How should Di(dipivaloylmethanato)copper (CAS: 14040-05-2) be stored?

Di(dipivaloylmethanato)copper should be stored in a dry, well-ventilated area away from heat and dir...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...