Compound Q&A

What is 4-Isopropoxybenzenesulfonyl chloride (CAS: 98995-40-5)?

Answer

4-Isopropoxybenzenesulfonyl chloride
4-Isopropoxybenzenesulfonyl chloride (CAS: 98995-40-5) is a chemical compound with the molecular formula C11H15O3S. It is a white solid with a molar mass of approximately 241.3 g/mol. This compound is characterized by its aromatic structure and a sulfonic acid group with an isopropoxy substituent.

About

CAS No 98995-40-5
English Name 4-Isopropoxybenzenesulfonyl chloride
Molecular Formula C9H11ClO3S
Molecular Weight 234.7 g/mol
SMILES CC(C)OC1=CC=C(C=C1)S(=O)(=O)Cl
InChIKey IJWCRHKAQNFJLT-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the main uses of 4-Isopropoxybenzenesulfonyl chloride (CAS: 98995-40-5)?

4-Isopropoxybenzenesulfonyl chloride (CAS: 98995-40-5) is primarily used in the pharmaceutical indus...

Compound Q&A

Is 4-Isopropoxybenzenesulfonyl chloride (CAS: 98995-40-5) safe?

4-Isopropoxybenzenesulfonyl chloride (CAS: 98995-40-5) is generally safe when handled according to r...

Compound Q&A

How should 4-Isopropoxybenzenesulfonyl chloride (CAS: 98995-40-5) be stored?

4-Isopropoxybenzenesulfonyl chloride (CAS: 98995-40-5) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...