Compound Q&A

What is 3-(3,5-Dimethoxyphenyl)acrylic acid (CAS: 16909-11-8)?

Answer

3-(3,5-Dimethoxyphenyl)acrylic acid
3-(3,5-Dimethoxyphenyl)acrylic acid (CAS: 16909-11-8) is a colorless or white crystalline compound with a molecular formula C12H12O4. It has a melting point of about 98-99°C and is soluble in water and organic solvents. The compound is known for its aromatic and acidic properties.

About

CAS No 16909-11-8
English Name 3-(3,5-Dimethoxyphenyl)acrylic acid
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES COC1=CC(=CC(=C1)C=CC(=O)O)OC
InChIKey VLSRUFWCGBMYDJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the main uses of 3-(3,5-Dimethoxyphenyl)acrylic acid (CAS: 16909-11-8)?

3-(3,5-Dimethoxyphenyl)acrylic acid (CAS: 16909-11-8) is primarily used as a raw material in the syn...

Compound Q&A

Is 3-(3,5-Dimethoxyphenyl)acrylic acid (CAS: 16909-11-8) safe?

3-(3,5-Dimethoxyphenyl)acrylic acid (CAS: 16909-11-8) is generally considered safe when handled acco...

Compound Q&A

How should 3-(3,5-Dimethoxyphenyl)acrylic acid (CAS: 16909-11-8) be stored?

3-(3,5-Dimethoxyphenyl)acrylic acid (CAS: 16909-11-8) should be stored in a cool, dry place, away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...