Compound Q&A

What are the main uses of Allyltriphenylphosphonium chloride (CAS: 18480-23-4)?

Answer

Allyltriphenylphosphonium chloride
Allyltriphenylphosphonium chloride (CAS: 18480-23-4) is primarily used in the synthesis of organic compounds and pharmaceuticals. It acts as a phosphonium salt, facilitating reactions and serving as a reagent in certain organic transformations. Its stability and reactivity make it valuable in laboratory settings.

About

CAS No 18480-23-4
English Name Allyltriphenylphosphonium chloride
Molecular Formula C21H20ClP
Molecular Weight 338.8 g/mol
SMILES C=CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]
InChIKey FKMJROWWQOJRJX-UHFFFAOYSA-M
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What is Allyltriphenylphosphonium chloride (CAS: 18480-23-4)?

Allyltriphenylphosphonium chloride (CAS: 18480-23-4) is an organophosphorus compound with the molecu...

Compound Q&A

Is Allyltriphenylphosphonium chloride (CAS: 18480-23-4) safe?

Allyltriphenylphosphonium chloride (CAS: 18480-23-4) is generally considered safe for laboratory use...

Compound Q&A

How should Allyltriphenylphosphonium chloride (CAS: 18480-23-4) be stored?

Allyltriphenylphosphonium chloride (CAS: 18480-23-4) should be stored in a tightly sealed container ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...