Compound Q&A

How should [2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid (CAS: 850568-04-6) be stored?

Answer

[2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid
[2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid should be stored at room temperature away from direct sunlight and moisture. It should be kept in a tightly sealed container to prevent degradation. Proper storage conditions are essential to maintain the stability and purity of the compound.

About

English Name [2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid
Molecular Formula C8H8BFO4
Molecular Weight 197.96 g/mol
SMILES COC(=O)c1ccc(c(c1)B(O)O)F
InChIKey MSASJWBQVSRTOE-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What is [2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid (CAS: 850568-04-6)?

[2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid, also known as 2-fluoro-5-(methoxycarbonyl)phenyl b...

Compound Q&A

What are the main uses of [2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid (CAS: 850568-04-6)?

[2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid has several applications in the pharmaceutical and ...

Compound Q&A

Is [2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid (CAS: 850568-04-6) safe?

[2-Fluoro-5-(methoxycarbonyl)phenyl]boronic acid is generally considered safe for laboratory and ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...