Compound Q&A

How should 2-(3-bromo-4-fluorophenyl)acetic acid (CAS: 194019-11-9) be stored?

Answer

2-(3-bromo-4-fluorophenyl)acetic acid
2-(3-bromo-4-fluorophenyl)acetic acid should be stored in a cool, dry place away from direct sunlight and heat sources. Maintain a temperature not exceeding 25°C and avoid excessive humidity to prevent degradation. Store in a tightly sealed container to protect from air and moisture exposure. Keep the compound away from incompatible materials such as strong oxidizers.

About

English Name 2-(3-bromo-4-fluorophenyl)acetic acid
Molecular Formula C8H6BrFO2
Molecular Weight 233.04 g/mol
SMILES C1=CC(=C(C=C1CC(=O)O)Br)F
InChIKey XXFGIJYSXNXNAU-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 2-(3-bromo-4-fluorophenyl)acetic acid (CAS: 194019-11-9)?

2-(3-bromo-4-fluorophenyl)acetic acid is an organic compound with the CAS number 194019-11-9. It has...

Compound Q&A

What are the main uses of 2-(3-bromo-4-fluorophenyl)acetic acid (CAS: 194019-11-9)?

2-(3-bromo-4-fluorophenyl)acetic acid is primarily used in the pharmaceutical industry for the synth...

Compound Q&A

Is 2-(3-bromo-4-fluorophenyl)acetic acid (CAS: 194019-11-9) safe?

2-(3-bromo-4-fluorophenyl)acetic acid is generally safe when handled with appropriate precautions. H...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...