Compound Q&A

What are the main uses of 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 849068-61-7)?

Answer

5-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
5-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 849068-61-7) is primarily used in the pharmaceutical and chemical industries. It serves as a precursor in the synthesis of other molecules and is explored for its potential in drug development. Additionally, it is utilized in research for its structural and functional properties.

About

English Name 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES OC(=O)c1c[nH]c2ncc(Br)cc12
InChIKey AFVRLQXVTZZPGE-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 849068-61-7)?

5-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 849068-61-7) is an organic compound with a...

Compound Q&A

Is 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 849068-61-7) safe?

5-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 849068-61-7) is generally safe when handle...

Compound Q&A

How should 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 849068-61-7) be stored?

5-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 849068-61-7) should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...