Compound Q&A

What is Dimethylamine-epichlorohydrincopolymer (CAS: 39660-17-8)?

Answer

Dimethylamine-epichlorohydrincopolymer
Dimethylamine-epichlorohydrincopolymer is a unique chemical compound with a combination of dimethylamine and epichlorohydrin. It is known for its excellent adhesion and water resistance properties. This compound is typically used in coatings, adhesives, and sealants.

About

CAS No 39660-17-8
English Name Dimethylamine-epichlorohydrincopolymer
Molecular Formula C5H8Cl2N2O
Molecular Weight 183.03582 g/mol
SMILES Cl/C(/C(/C(=N/C)/Cl)O)=N\C
InChIKey LTKVMEDGMDZEMD-XEQVNJCQSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of Dimethylamine-epichlorohydrincopolymer (CAS: 39660-17-8)?

Dimethylamine-epichlorohydrincopolymer is primarily used in the manufacturing of coatings, adhesives...

Compound Q&A

Is Dimethylamine-epichlorohydrincopolymer (CAS: 39660-17-8) safe?

Dimethylamine-epichlorohydrincopolymer is generally considered safe when used as directed. However, ...

Compound Q&A

How should Dimethylamine-epichlorohydrincopolymer (CAS: 39660-17-8) be stored?

Dimethylamine-epichlorohydrincopolymer should be stored in a cool, dry place away from direct sunlig...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...