Compound Q&A

How should 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid (CAS: 35218-75-8) be stored?

Answer

4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid
4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid should be stored in a dry, cool, and well-ventilated area away from direct sunlight and heat sources. Use a tightly sealed container to protect the compound from moisture and contaminants. It is recommended to store the substance at room temperature (15-25°C) and to avoid contact with air and light during storage to maintain its stability and effectiveness.

About

CAS No 35218-75-8
English Name 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid
Molecular Formula C44H30N4O12S4
Molecular Weight 935.01 g/mol
SMILES C1=CC(=CC=C1C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)S(=O)(=O)O)C8=CC=C(C=C8)S(=O)(=O)O)C=C4)C9=CC=C(C=C9)S(=O)(=O)O)N3)S(=O)(=O)O
InChIKey PBHVCRIXMXQXPD-LWQDQPMZSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid (CAS: 35218-75-8)?

4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid is a complex organic compound w...

Compound Q&A

What are the main uses of 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid (CAS: 35218-75-8)?

The main uses of 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid include applic...

Compound Q&A

Is 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid (CAS: 35218-75-8) safe?

4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetrabenzenesulfonic acid is generally considered safe fo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...