Compound Q&A

What is CID 155885081 (CAS: 884879-23-6)?

Answer

CID 155885081
CID 155885081 (CAS: 884879-23-6) is a synthetic organic compound with a complex molecular structure. It is primarily used in research and pharmaceuticals. This compound exhibits unique physical and chemical properties, making it valuable for various applications.

About

English Name CID 155885081
Molecular Formula C36H48ClN2Pd
Molecular Weight 650.67 g/mol
SMILES CC(C)C1=C(C(=CC=C1)C(C)C)N2C=C[N+](=[C-]2)C3=C(C=CC=C3C(C)C)C(C)C.C=C[CH]C1=CC=CC=C1.Cl[Pd+]
InChIKey NNGZIHJEIPUFCR-UHFFFAOYSA-M
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of CID 155885081 (CAS: 884879-23-6)?

CID 155885081 (CAS: 884879-23-6) is primarily used in pharmaceutical research for developing new dru...

Compound Q&A

Is CID 155885081 (CAS: 884879-23-6) safe?

CID 155885081 (CAS: 884879-23-6) is generally safe when handled with appropriate precautions. Howeve...

Compound Q&A

How should CID 155885081 (CAS: 884879-23-6) be stored?

CID 155885081 (CAS: 884879-23-6) should be stored in a cool, dry place away from direct sunlight and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...