Compound Q&A

What is 2,5-Dibromothiophene-3,4-dicarboxylic acid (CAS: 190723-12-7)?

Answer

2,5-Dibromothiophene-3,4-dicarboxylic acid
2,5-Dibromothiophene-3,4-dicarboxylic acid is a dibrominated thiophene derivative with the chemical formula C6H2Br2O4. It is a white solid with a distinctive odor. This compound is known for its aromatic and acidic properties.

About

English Name 2,5-Dibromothiophene-3,4-dicarboxylic acid
Molecular Formula C6H2Br2O4S
Molecular Weight 329.95 g/mol
SMILES C1(=C(SC(=C1C(=O)O)Br)Br)C(=O)O
InChIKey ZZYYIZHQMCEKLG-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of 2,5-Dibromothiophene-3,4-dicarboxylic acid (CAS: 190723-12-7)?

2,5-Dibromothiophene-3,4-dicarboxylic acid is primarily used in the synthesis of dyes and pigments d...

Compound Q&A

Is 2,5-Dibromothiophene-3,4-dicarboxylic acid (CAS: 190723-12-7) safe?

2,5-Dibromothiophene-3,4-dicarboxylic acid is generally considered safe under normal handling condit...

Compound Q&A

How should 2,5-Dibromothiophene-3,4-dicarboxylic acid (CAS: 190723-12-7) be stored?

2,5-Dibromothiophene-3,4-dicarboxylic acid should be stored in a cool, dry place away from direct su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...