Compound Q&A

What is 10,10'-Dimethyl-9,9'-biacridinium dinitrate (CAS: 2315-97-1)?

Answer

10,10'-Dimethyl-9,9'-biacridinium dinitrate
10,10'-Dimethyl-9,9'-biacridinium dinitrate (CAS: 2315-97-1) is a complex organic compound that consists of two acridine rings joined by a methylene bridge, with two methyl groups attached to the central nitrogen atoms. It is a solid, crystalline compound with a high melting point and stable under normal conditions.

About

CAS No 2315-97-1
English Name 10,10'-Dimethyl-9,9'-biacridinium dinitrate
Molecular Formula C28H22N4O6
Molecular Weight 510.5 g/mol
SMILES C[N+]1=C2C=CC=CC2=C(C3=CC=CC=C31)C4=C5C=CC=CC5=[N+](C6=CC=CC=C64)C.[N+](=O)([O-])[O-].[N+](=O)([O-])[O-]
InChIKey KNJDBYZZKAZQNG-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of 10,10'-Dimethyl-9,9'-biacridinium dinitrate (CAS: 2315-97-1)?

10,10'-Dimethyl-9,9'-biacridinium dinitrate (CAS: 2315-97-1) has applications in pharmaceuticals, pa...

Compound Q&A

Is 10,10'-Dimethyl-9,9'-biacridinium dinitrate (CAS: 2315-97-1) safe?

10,10'-Dimethyl-9,9'-biacridinium dinitrate (CAS: 2315-97-1) is generally considered safe when handl...

Compound Q&A

How should 10,10'-Dimethyl-9,9'-biacridinium dinitrate (CAS: 2315-97-1) be stored?

10,10'-Dimethyl-9,9'-biacridinium dinitrate (CAS: 2315-97-1) should be stored in a cool, dry place w...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...