Compound Q&A

What are the main uses of (S)-2-((S)-2-Cyclohexyl-2-(pyrazine-2-carboxamido)acetamido)-3,3-dimethylbutanoic acid (CAS: 402958-96-7)?

Answer

(S)-2-((S)-2-Cyclohexyl-2-(pyrazine-2-carboxamido)acetamido)-3,3-dimethylbutanoic acid
This compound is mainly used in pharmaceutical research for drug discovery and development, particularly for the synthesis of potential therapeutic agents. It may also have applications in the development of new antibiotics or antiviral treatments.

About

English Name (S)-2-((S)-2-Cyclohexyl-2-(pyrazine-2-carboxamido)acetamido)-3,3-dimethylbutanoic acid
Molecular Formula C19H28N4O4
Molecular Weight 376.46 g/mol
SMILES O=C([C@H](C1CCCCC1)NC(=O)c1nccnc1)N[C@@H](C(C)(C)C)C(=O)O
InChIKey BZUKJNKTPCZNPM-LSDHHAIUSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is (S)-2-((S)-2-Cyclohexyl-2-(pyrazine-2-carboxamido)acetamido)-3,3-dimethylbutanoic acid (CAS: 402958-96-7)?

This compound is a specific amino acid derivative with a complex structure. It is characterized by i...

Compound Q&A

Is (S)-2-((S)-2-Cyclohexyl-2-(pyrazine-2-carboxamido)acetamido)-3,3-dimethylbutanoic acid (CAS: 402958-96-7) safe?

This compound is considered safe under controlled laboratory conditions when proper safety precautio...

Compound Q&A

How should (S)-2-((S)-2-Cyclohexyl-2-(pyrazine-2-carboxamido)acetamido)-3,3-dimethylbutanoic acid (CAS: 402958-96-7) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and moisture. It shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...