Compound Q&A

What is 4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid (CAS: 1353016-70-2)?

Answer

4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid
4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid is a chemical compound with the CAS number 1353016-70-2. It is an organic compound characterized by its azocin ring system and carboxylic acid functional group. This compound is primarily used in pharmaceutical and research applications due to its structural complexity and potential biological activities.

About

English Name 4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid
Molecular Formula C19H15NO3
Molecular Weight 305.33 g/mol
SMILES OC(=O)CCC(=O)N1Cc2ccccc2C#Cc3ccccc13
InChIKey NDLOVDOICXITOK-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of 4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid (CAS: 1353016-70-2)?

The main uses of 4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid (CAS: 1353016-70-...

Compound Q&A

Is 4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid (CAS: 1353016-70-2) safe?

4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid (CAS: 1353016-70-2) is generally c...

Compound Q&A

How should 4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid (CAS: 1353016-70-2) be stored?

4-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-4-oxobutanoic acid (CAS: 1353016-70-2) should be stor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...