Compound Q&A

What are the main uses of (3,4-Dichlorophenyl)(phenyl)methanone (CAS: 6284-79-3)?

Answer

(3,4-Dichlorophenyl)(phenyl)methanone
(3,4-Dichlorophenyl)(phenyl)methanone is primarily used as an intermediate in the synthesis of pharmaceuticals. It plays a crucial role in the production of various drugs and can also be used in research and development for drug discovery.

About

CAS No 6284-79-3
English Name (3,4-Dichlorophenyl)(phenyl)methanone
Molecular Formula C13H8Cl2O
Molecular Weight 251.11 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)Cl)Cl
InChIKey LLUPHTAYNHAVQT-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is (3,4-Dichlorophenyl)(phenyl)methanone (CAS: 6284-79-3)?

(3,4-Dichlorophenyl)(phenyl)methanone is a organic compound with the CAS number 6284-79-3. It is a y...

Compound Q&A

Is (3,4-Dichlorophenyl)(phenyl)methanone (CAS: 6284-79-3) safe?

(3,4-Dichlorophenyl)(phenyl)methanone is generally considered safe when handled with proper precauti...

Compound Q&A

How should (3,4-Dichlorophenyl)(phenyl)methanone (CAS: 6284-79-3) be stored?

(3,4-Dichlorophenyl)(phenyl)methanone should be stored at room temperature, between 15-25°C, in a ti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...