Compound Q&A

What is 2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside (CAS: 157843-41-9)?

Answer

2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside
2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside (CAS: 157843-41-9) is a glycoside compound with a chloro and nitro substituent at specific positions on the phenyl ring. It is used in various research applications, particularly in organic chemistry and biochemistry due to its structural complexity and functional groups.

About

English Name 2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside
Molecular Formula C12H14ClNO7
Molecular Weight 319.69 g/mol
SMILES CC1C(C(C(C(O1)OC2=C(C=C(C=C2)[N+](=O)[O-])Cl)O)O)O
InChIKey QURSGHQPKUXLAD-MOBXTKCLSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of 2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside (CAS: 157843-41-9)?

2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside (CAS: 157843-41-9) is primarily used in pha...

Compound Q&A

Is 2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside (CAS: 157843-41-9) safe?

2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside (CAS: 157843-41-9) can be handled safely wi...

Compound Q&A

How should 2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside (CAS: 157843-41-9) be stored?

2-Chloro-4-nitrophenyl 6-deoxy-alpha-L-galactopyranoside (CAS: 157843-41-9) should be stored in a co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...