Compound Q&A

How should 4-Bromo-3-nitrobenzoic acid (CAS: 6319-40-0) be stored?

Answer

4-Bromo-3-nitrobenzoic acid
4-Bromo-3-nitrobenzoic acid (CAS: 6319-40-0) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. The storage temperature should not exceed 25°C (77°F) to ensure stability and safety.

About

CAS No 6319-40-0
English Name 4-Bromo-3-nitrobenzoic acid
Molecular Formula C7H4BrNO4
Molecular Weight 246.01 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])Br
InChIKey RVCTZJVBWNFYRU-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 4-Bromo-3-nitrobenzoic acid (CAS: 6319-40-0)?

4-Bromo-3-nitrobenzoic acid (CAS: 6319-40-0) is an organic compound with the molecular formula C7H4B...

Compound Q&A

What are the main uses of 4-Bromo-3-nitrobenzoic acid (CAS: 6319-40-0)?

4-Bromo-3-nitrobenzoic acid (CAS: 6319-40-0) is primarily used in the synthesis of other organic com...

Compound Q&A

Is 4-Bromo-3-nitrobenzoic acid (CAS: 6319-40-0) safe?

4-Bromo-3-nitrobenzoic acid (CAS: 6319-40-0) is generally considered safe when handled with proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...