Compound Q&A

What is 1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene (CAS: 921205-03-0)?

Answer

1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene
1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene is a complex aromatic compound with the CAS number 921205-03-0. It consists of a central benzene ring with three pyridyl-substituted phenyl groups. This compound is characterized by its stability and unique electronic properties.

About

English Name 1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene
Molecular Formula C39H27N3
Molecular Weight 537.67 g/mol
SMILES C1=CC(=CC(=C1)C2=CC(=CC(=C2)C3=CC=CC(=C3)C4=CN=CC=C4)C5=CC=CC(=C5)C6=CN=CC=C6)C7=CN=CC=C7
InChIKey CINYXYWQPZSTOT-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of 1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene (CAS: 921205-03-0)?

1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene is primarily used in the development of organic electronic d...

Compound Q&A

Is 1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene (CAS: 921205-03-0) safe?

1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene is generally safe when handled with appropriate precautions....

Compound Q&A

How should 1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene (CAS: 921205-03-0) be stored?

1,3,5-Tri[(3-pyridyl)-phen-3-yl]benzene should be stored in a cool, dry place away from direct sunli...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...