Compound Q&A

What are the main uses of 3-Hydroxy-5-nitrobenzoic acid (CAS: 78238-14-9)?

Answer

3-Hydroxy-5-nitrobenzoic acid
3-Hydroxy-5-nitrobenzoic acid is primarily used in pharmaceutical research as a precursor for the synthesis of drugs. It also finds applications in the production of pigments and dyes, and as a reagent in various chemical reactions.

About

CAS No 78238-14-9
English Name 3-Hydroxy-5-nitrobenzoic acid
Molecular Formula C7H5NO5
Molecular Weight 183.12 g/mol
SMILES C1=C(C=C(C=C1[N+](=O)[O-])O)C(=O)O
InChIKey ZVLLYIMPDTXFNC-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 3-Hydroxy-5-nitrobenzoic acid (CAS: 78238-14-9)?

3-Hydroxy-5-nitrobenzoic acid is an organic compound with the molecular formula C7H5NO4. It is chara...

Compound Q&A

Is 3-Hydroxy-5-nitrobenzoic acid (CAS: 78238-14-9) safe?

3-Hydroxy-5-nitrobenzoic acid is generally considered safe when handled with appropriate precautions...

Compound Q&A

How should 3-Hydroxy-5-nitrobenzoic acid (CAS: 78238-14-9) be stored?

3-Hydroxy-5-nitrobenzoic acid should be stored in a cool, dry place away from direct sunlight and he...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...