Compound Q&A

What is 5-Bromo-1H-indazole-3-carboxylic acid (CAS: 1077-94-7)?

Answer

5-Bromo-1H-indazole-3-carboxylic acid
5-Bromo-1H-indazole-3-carboxylic acid (CAS: 1077-94-7) is a chemical compound with the molecular formula C8H5BrNO2. It is a white or off-white solid, soluble in water and organic solvents. This compound is often used in medicinal chemistry and as an intermediate in the synthesis of other organic compounds.

About

CAS No 1077-94-7
English Name 5-Bromo-1H-indazole-3-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=CC2=C(C=C1Br)C(=NN2)C(=O)O
InChIKey AMJVXOOGGBPVCZ-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What are the main uses of 5-Bromo-1H-indazole-3-carboxylic acid (CAS: 1077-94-7)?

5-Bromo-1H-indazole-3-carboxylic acid (CAS: 1077-94-7) is primarily used in the pharmaceutical indus...

Compound Q&A

Is 5-Bromo-1H-indazole-3-carboxylic acid (CAS: 1077-94-7) safe?

5-Bromo-1H-indazole-3-carboxylic acid (CAS: 1077-94-7) is generally considered safe when handled wit...

Compound Q&A

How should 5-Bromo-1H-indazole-3-carboxylic acid (CAS: 1077-94-7) be stored?

5-Bromo-1H-indazole-3-carboxylic acid (CAS: 1077-94-7) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...