Compound Q&A

What are the main uses of Methyl 3,5-dinitrobenzoate (CAS: 2702-58-1)?

Answer

Methyl 3,5-dinitrobenzoate
Methyl 3,5-dinitrobenzoate (CAS: 2702-58-1) is primarily used as a precursor in the synthesis of various dyes, pharmaceuticals, and other organic compounds. It is also used as a reagent in analytical chemistry and as a component in the production of certain pesticides.

About

CAS No 2702-58-1
English Name Methyl 3,5-dinitrobenzoate
Molecular Formula C8H6N2O6
Molecular Weight 226.14 g/mol
SMILES COC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-]
InChIKey POGCCFLNFPIIGW-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is Methyl 3,5-dinitrobenzoate (CAS: 2702-58-1)?

Methyl 3,5-dinitrobenzoate (CAS: 2702-58-1) is an organic compound with the molecular formula C8H6N2...

Compound Q&A

Is Methyl 3,5-dinitrobenzoate (CAS: 2702-58-1) safe?

Methyl 3,5-dinitrobenzoate (CAS: 2702-58-1) is generally considered safe when handled under proper c...

Compound Q&A

How should Methyl 3,5-dinitrobenzoate (CAS: 2702-58-1) be stored?

Methyl 3,5-dinitrobenzoate (CAS: 2702-58-1) should be stored in a tightly closed container in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...