Compound Q&A

What is Benzyl D-leucinate 4-methylbenzenesulfonate (CAS: 17664-93-6)?

Answer

Benzyl D-leucinate 4-methylbenzenesulfonate (1:1)
Benzyl D-leucinate 4-methylbenzenesulfonate (CAS: 17664-93-6) is a compound used in pharmaceutical and chemical research. It consists of benzyl, D-leucinate, and 4-methylbenzenesulfonate groups. This compound has a molecular weight of approximately 338.45 g/mol and is typically white to light yellow crystalline powder.

About

CAS No 17664-93-6
English Name Benzyl D-leucinate 4-methylbenzenesulfonate (1:1)
Molecular Formula C20H27NO5S
Molecular Weight 393.51 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)CC(C(=O)OCC1=CC=CC=C1)N
InChIKey QTQGHKVYLQBJLO-UTONKHPSSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What are the main uses of Benzyl D-leucinate 4-methylbenzenesulfonate (CAS: 17664-93-6)?

Benzyl D-leucinate 4-methylbenzenesulfonate (CAS: 17664-93-6) is primarily used in pharmaceuticals a...

Compound Q&A

Is Benzyl D-leucinate 4-methylbenzenesulfonate (CAS: 17664-93-6) safe?

Benzyl D-leucinate 4-methylbenzenesulfonate (CAS: 17664-93-6) is generally considered safe under nor...

Compound Q&A

How should Benzyl D-leucinate 4-methylbenzenesulfonate (CAS: 17664-93-6) be stored?

Benzyl D-leucinate 4-methylbenzenesulfonate (CAS: 17664-93-6) should be stored in a cool, dry place,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...